About 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one
3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one (PubChem CID 130251014) has the molecular formula C6H5N3OS
and a molecular weight of 167.19 g/mol. Its IUPAC name is 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one |
| PubChem CID | 130251014 |
| Molecular Formula | C6H5N3OS |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one |
| SMILES | Cn1c(=O)sc2nccnc21 |
| InChI | InChI=1S/C6H5N3OS/c1-9-4-5(11-6(9)10)8-3-2-7-4/h2-3H,1H3 |
| InChIKey | FZJPDZLRVCCCPY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one?
The IUPAC name of 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one (CID 130251014) is 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one?
The canonical SMILES for 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one is Cn1c(=O)sc2nccnc21.
What is the InChIKey of 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one?
The InChIKey is FZJPDZLRVCCCPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3OS/c1-9-4-5(11-6(9)10)8-3-2-7-4/h2-3H,1H3.
What are the key properties of 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one?
3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one has a molecular weight of 167.19 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-[1,3]thiazolo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 130251014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).