About 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole
2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole (PubChem CID 130251140) has the molecular formula C7H9NOS
and a molecular weight of 155.22 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole.
Molecular Properties
| Compound Name | 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole |
| PubChem CID | 130251140 |
| Molecular Formula | C7H9NOS |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole |
| SMILES | Cc1nc2c(o1)CCCS2 |
| InChI | InChI=1S/C7H9NOS/c1-5-8-7-6(9-5)3-2-4-10-7/h2-4H2,1H3 |
| InChIKey | CUKRXTUANUTFSZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole?
The IUPAC name of 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole (CID 130251140) is 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole.
What is the SMILES notation for 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole?
The canonical SMILES for 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole is Cc1nc2c(o1)CCCS2.
What is the InChIKey of 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole?
The InChIKey is CUKRXTUANUTFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NOS/c1-5-8-7-6(9-5)3-2-4-10-7/h2-4H2,1H3.
What are the key properties of 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole?
2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole has a molecular weight of 155.22 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydro-5H-thiopyrano[2,3-d][1,3]oxazole is sourced from PubChem (CID 130251140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).