About 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide
1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide (PubChem CID 130251291) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide.
Molecular Properties
| Compound Name | 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide |
| PubChem CID | 130251291 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide |
| SMILES | Cn1ncc2c1CCCS2=O |
| InChI | InChI=1S/C7H10N2OS/c1-9-6-3-2-4-11(10)7(6)5-8-9/h5H,2-4H2,1H3 |
| InChIKey | SNQIJCPXFVNEPC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide?
The IUPAC name of 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide (CID 130251291) is 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide.
What is the SMILES notation for 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide?
The canonical SMILES for 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide is Cn1ncc2c1CCCS2=O.
What is the InChIKey of 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide?
The InChIKey is SNQIJCPXFVNEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-9-6-3-2-4-11(10)7(6)5-8-9/h5H,2-4H2,1H3.
What are the key properties of 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide?
1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide has a molecular weight of 170.24 g/mol, XLogP of 0.47, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6,7-dihydro-5H-thiopyrano[2,3-d]pyrazole 4-oxide is sourced from PubChem (CID 130251291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).