About 2-methylpyrrolo[1,2-a]pyrimidine
2-methylpyrrolo[1,2-a]pyrimidine (PubChem CID 130251328) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 2-methylpyrrolo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 2-methylpyrrolo[1,2-a]pyrimidine |
|---|
| PubChem CID | 130251328 |
|---|
| Molecular Formula | C8H8N2 |
|---|
| Molecular Weight | 132.17 g/mol |
|---|
| Exact Mass | 132.07 |
|---|
| IUPAC Name | 2-methylpyrrolo[1,2-a]pyrimidine |
|---|
| SMILES | Cc1ccn2cccc2n1 |
|---|
| InChI | InChI=1S/C8H8N2/c1-7-4-6-10-5-2-3-8(10)9-7/h2-6H,1H3 |
|---|
| InChIKey | SURDBAXCUBKPIL-UHFFFAOYSA-N |
|---|
| XLogP | 1.64 |
|---|
| TPSA | 17.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpyrrolo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpyrrolo[1,2-a]pyrimidine?
The IUPAC name of 2-methylpyrrolo[1,2-a]pyrimidine (CID 130251328) is 2-methylpyrrolo[1,2-a]pyrimidine.
What is the SMILES notation for 2-methylpyrrolo[1,2-a]pyrimidine?
The canonical SMILES for 2-methylpyrrolo[1,2-a]pyrimidine is Cc1ccn2cccc2n1.
What is the InChIKey of 2-methylpyrrolo[1,2-a]pyrimidine?
The InChIKey is SURDBAXCUBKPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-7-4-6-10-5-2-3-8(10)9-7/h2-6H,1H3.
What are the key properties of 2-methylpyrrolo[1,2-a]pyrimidine?
2-methylpyrrolo[1,2-a]pyrimidine has a molecular weight of 132.17 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpyrrolo[1,2-a]pyrimidine is sourced from PubChem (CID 130251328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).