About 4-methylpyrazino[2,3-b][1,4]oxazin-3-one
4-methylpyrazino[2,3-b][1,4]oxazin-3-one (PubChem CID 130251557) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-methylpyrazino[2,3-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 4-methylpyrazino[2,3-b][1,4]oxazin-3-one |
| PubChem CID | 130251557 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 4-methylpyrazino[2,3-b][1,4]oxazin-3-one |
| SMILES | CN1C(=O)COc2nccnc21 |
| InChI | InChI=1S/C7H7N3O2/c1-10-5(11)4-12-7-6(10)8-2-3-9-7/h2-3H,4H2,1H3 |
| InChIKey | FUFLMQIOCVPAHO-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylpyrazino[2,3-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyrazino[2,3-b][1,4]oxazin-3-one?
The IUPAC name of 4-methylpyrazino[2,3-b][1,4]oxazin-3-one (CID 130251557) is 4-methylpyrazino[2,3-b][1,4]oxazin-3-one.
What is the SMILES notation for 4-methylpyrazino[2,3-b][1,4]oxazin-3-one?
The canonical SMILES for 4-methylpyrazino[2,3-b][1,4]oxazin-3-one is CN1C(=O)COc2nccnc21.
What is the InChIKey of 4-methylpyrazino[2,3-b][1,4]oxazin-3-one?
The InChIKey is FUFLMQIOCVPAHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-10-5(11)4-12-7-6(10)8-2-3-9-7/h2-3H,4H2,1H3.
What are the key properties of 4-methylpyrazino[2,3-b][1,4]oxazin-3-one?
4-methylpyrazino[2,3-b][1,4]oxazin-3-one has a molecular weight of 165.15 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyrazino[2,3-b][1,4]oxazin-3-one is sourced from PubChem (CID 130251557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).