About 5-methyloxadiazolo[5,4-d]pyrimidine
5-methyloxadiazolo[5,4-d]pyrimidine (PubChem CID 130251751) has the molecular formula C5H4N4O
and a molecular weight of 136.11 g/mol. Its IUPAC name is 5-methyloxadiazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 5-methyloxadiazolo[5,4-d]pyrimidine |
| PubChem CID | 130251751 |
| Molecular Formula | C5H4N4O |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 5-methyloxadiazolo[5,4-d]pyrimidine |
| SMILES | Cc1ncc2nnoc2n1 |
| InChI | InChI=1S/C5H4N4O/c1-3-6-2-4-5(7-3)10-9-8-4/h2H,1H3 |
| InChIKey | PEKOTUHLIYJORQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyloxadiazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyloxadiazolo[5,4-d]pyrimidine?
The IUPAC name of 5-methyloxadiazolo[5,4-d]pyrimidine (CID 130251751) is 5-methyloxadiazolo[5,4-d]pyrimidine.
What is the SMILES notation for 5-methyloxadiazolo[5,4-d]pyrimidine?
The canonical SMILES for 5-methyloxadiazolo[5,4-d]pyrimidine is Cc1ncc2nnoc2n1.
What is the InChIKey of 5-methyloxadiazolo[5,4-d]pyrimidine?
The InChIKey is PEKOTUHLIYJORQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4O/c1-3-6-2-4-5(7-3)10-9-8-4/h2H,1H3.
What are the key properties of 5-methyloxadiazolo[5,4-d]pyrimidine?
5-methyloxadiazolo[5,4-d]pyrimidine has a molecular weight of 136.11 g/mol, XLogP of 0.32, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyloxadiazolo[5,4-d]pyrimidine is sourced from PubChem (CID 130251751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).