C16H25F3N2O3 — CID 130252121
(2S)-3-methyl-2-[[(2R)-1,1,1-trifluoro-7-(5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid (PubChem CID 130252121) has the molecular formula C16H25F3N2O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2R)-1,1,1-trifluoro-7-(5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2R)-1,1,1-trifluoro-7-(5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 130252121 |
| Molecular Formula | C16H25F3N2O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2S)-3-methyl-2-[[(2R)-1,1,1-trifluoro-7-(5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid |
| SMILES | CC(C)[C@H](N[C@H](CCCCCN1CC=CC1=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H25F3N2O3/c1-11(2)14(15(23)24)20-12(16(17,18)19)7-4-3-5-9-21-10-6-8-13(21)22/h6,8,11-12,14,20H,3-5,7,9-10H2,1-2H3,(H,23,24)/t12-,14+/m1/s1 |
| InChIKey | BJADSACDZQIEDM-OCCSQVGLSA-N |
| XLogP | 2.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|