C16H25F3N2O4 — CID 130252122
(2S)-3-methyl-2-[[(2S)-1,1,1-trifluoro-7-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid (PubChem CID 130252122) has the molecular formula C16H25F3N2O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[(2S)-1,1,1-trifluoro-7-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid.
| Compound Name | (2S)-3-methyl-2-[[(2S)-1,1,1-trifluoro-7-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 130252122 |
| Molecular Formula | C16H25F3N2O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (2S)-3-methyl-2-[[(2S)-1,1,1-trifluoro-7-(2-hydroxy-5-oxo-2H-pyrrol-1-yl)heptan-2-yl]amino]butanoic acid |
| SMILES | CC(C)[C@H](N[C@@H](CCCCCN1C(=O)C=CC1O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H25F3N2O4/c1-10(2)14(15(24)25)20-11(16(17,18)19)6-4-3-5-9-21-12(22)7-8-13(21)23/h7-8,10-12,14,20,22H,3-6,9H2,1-2H3,(H,24,25)/t11-,12?,14-/m0/s1 |
| InChIKey | ISFOWVMUDMAJRS-PSIKVXPXSA-N |
| XLogP | 1.89 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|