C13H15N3 — CID 130252124
(6Z,11Z)-10,13-dimethylidene-1,3,8-triazacyclotetradeca-2,6,8,11,14-pentaene (PubChem CID 130252124) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (6Z,11Z)-10,13-dimethylidene-1,3,8-triazacyclotetradeca-2,6,8,11,14-pentaene.
| Compound Name | (6Z,11Z)-10,13-dimethylidene-1,3,8-triazacyclotetradeca-2,6,8,11,14-pentaene |
|---|---|
| PubChem CID | 130252124 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | (6Z,11Z)-10,13-dimethylidene-1,3,8-triazacyclotetradeca-2,6,8,11,14-pentaene |
| SMILES | C=C1/C=C\C(=C)/C=N/C=N\CC/C=C\N=C\1 |
| InChI | InChI=1S/C13H15N3/c1-12-5-6-13(2)10-16-11-15-8-4-3-7-14-9-12/h3,5-7,9-11H,1-2,4,8H2/b6-5-,7-3-,14-9+,15-11-,16-10+ |
| InChIKey | MNEYKFGCXUIKFG-CRXDTOAFSA-N |
| XLogP | 2.74 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |