C20H26F3N3O6 — CID 130252177
(2,5-dioxopyrrolidin-1-yl) 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate (PubChem CID 130252177) has the molecular formula C20H26F3N3O6 and a molecular weight of 461.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 130252177 |
| Molecular Formula | C20H26F3N3O6 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[[7-(2,5-dioxopyrrol-1-yl)-1,1,1-trifluoroheptan-2-yl]amino]-3-methylbutanoate |
| SMILES | CC(C)C(NC(CCCCCN1C(=O)C=CC1=O)C(F)(F)F)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C20H26F3N3O6/c1-12(2)18(19(31)32-26-16(29)9-10-17(26)30)24-13(20(21,22)23)6-4-3-5-11-25-14(27)7-8-15(25)28/h7-8,12-13,18,24H,3-6,9-11H2,1-2H3 |
| InChIKey | VDOTWAHSNFHMDM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|