C13H20F3NO2 — CID 130252259
3-methyl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione (PubChem CID 130252259) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-methyl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 130252259 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-methyl-1-[(6R)-7,7,7-trifluoro-6-methylheptyl]pyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCCCC[C@@H](C)C(F)(F)F)C1=O |
| InChI | InChI=1S/C13H20F3NO2/c1-9-8-11(18)17(12(9)19)7-5-3-4-6-10(2)13(14,15)16/h9-10H,3-8H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | HNMFFQOXZDKFRU-QVDQXJPCSA-N |
| XLogP | 3.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|