About 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran
4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran (PubChem CID 13025240) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran.
Molecular Properties
| Compound Name | 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran |
| PubChem CID | 13025240 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran |
| SMILES | CC1=CC(C)(CC(C)C)OCC1 |
| InChI | InChI=1S/C11H20O/c1-9(2)7-11(4)8-10(3)5-6-12-11/h8-9H,5-7H2,1-4H3 |
| InChIKey | HLMIXRXIEMLQRZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran?
The IUPAC name of 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran (CID 13025240) is 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran.
What is the SMILES notation for 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran?
The canonical SMILES for 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran is CC1=CC(C)(CC(C)C)OCC1.
What is the InChIKey of 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran?
The InChIKey is HLMIXRXIEMLQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-9(2)7-11(4)8-10(3)5-6-12-11/h8-9H,5-7H2,1-4H3.
What are the key properties of 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran?
4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran has a molecular weight of 168.28 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-6-(2-methylpropyl)-2,3-dihydropyran is sourced from PubChem (CID 13025240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).