C32H46N4O4 — CID 130252414
2-[(2S,3R,4R)-1-[6-[1-[5-(2,2-dimethylcyclopentyl)-2-methoxy-4-pyridinyl]-3-methylpiperidin-4-yl]oxy-3-pyridinyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid (PubChem CID 130252414) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is 2-[(2S,3R,4R)-1-[6-[1-[5-(2,2-dimethylcyclopentyl)-2-methoxy-4-pyridinyl]-3-methylpiperidin-4-yl]oxy-3-pyridinyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4R)-1-[6-[1-[5-(2,2-dimethylcyclopentyl)-2-methoxy-4-pyridinyl]-3-methylpiperidin-4-yl]oxy-3-pyridinyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 130252414 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 2-[(2S,3R,4R)-1-[6-[1-[5-(2,2-dimethylcyclopentyl)-2-methoxy-4-pyridinyl]-3-methylpiperidin-4-yl]oxy-3-pyridinyl]-3,4-dimethylpyrrolidin-2-yl]acetic acid |
| SMILES | COc1cc(N2CCC(Oc3ccc(N4C[C@H](C)[C@@H](C)[C@@H]4CC(=O)O)cn3)C(C)C2)c(C2CCCC2(C)C)cn1 |
| InChI | InChI=1S/C32H46N4O4/c1-20-19-36(26(22(20)3)15-31(37)38)23-9-10-29(33-16-23)40-28-11-13-35(18-21(28)2)27-14-30(39-6)34-17-24(27)25-8-7-12-32(25,4)5/h9-10,14,16-17,20-22,25-26,28H,7-8,11-13,15,18-19H2,1-6H3,(H,37,38)/t20-,21?,22+,25?,26-,28?/m0/s1 |
| InChIKey | QBRNGTFMSUCVIV-VFHBWYKSSA-N |
| XLogP | 6.01 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |