C47H42N4O — CID 130252643
5,7-bis(2,6-dimethylphenyl)-17-[4-(hexylamino)phenyl]-11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-15-carbonitrile (PubChem CID 130252643) has the molecular formula C47H42N4O and a molecular weight of 678.88 g/mol. Its IUPAC name is 5,7-bis(2,6-dimethylphenyl)-17-[4-(hexylamino)phenyl]-11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-15-carbonitrile.
| Compound Name | 5,7-bis(2,6-dimethylphenyl)-17-[4-(hexylamino)phenyl]-11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-15-carbonitrile |
|---|---|
| PubChem CID | 130252643 |
| Molecular Formula | C47H42N4O |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | 5,7-bis(2,6-dimethylphenyl)-17-[4-(hexylamino)phenyl]-11-oxo-3,10-diazapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1(19),2,4,6,8,12(20),13,15,17-nonaene-15-carbonitrile |
| SMILES | CCCCCCNc1ccc(-c2ccc3c4c2c(C#N)ccc4c(=O)n2c4cc(-c5c(C)cccc5C)cc(-c5c(C)cccc5C)c4nc32)cc1 |
| InChI | InChI=1S/C47H42N4O/c1-6-7-8-9-24-49-35-19-16-32(17-20-35)36-22-23-37-44-38(21-18-33(27-48)43(36)44)47(52)51-40-26-34(41-28(2)12-10-13-29(41)3)25-39(45(40)50-46(37)51)42-30(4)14-11-15-31(42)5/h10-23,25-26,49H,6-9,24H2,1-5H3 |
| InChIKey | PVZMNAOJHRGVDI-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 70.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|