C13H20N2O3 — CID 130252714
tert-butyl (1R,2R,4S,5S,7S)-7-carbamoyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate (PubChem CID 130252714) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is tert-butyl (1R,2R,4S,5S,7S)-7-carbamoyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate.
| Compound Name | tert-butyl (1R,2R,4S,5S,7S)-7-carbamoyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate |
|---|---|
| PubChem CID | 130252714 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | tert-butyl (1R,2R,4S,5S,7S)-7-carbamoyl-6-azatricyclo[3.2.1.02,4]octane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C(N)=O)[C@@H]2C[C@H]1[C@H]1C[C@@H]21 |
| InChI | InChI=1S/C13H20N2O3/c1-13(2,3)18-12(17)15-9-5-8(6-4-7(6)9)10(15)11(14)16/h6-10H,4-5H2,1-3H3,(H2,14,16)/t6-,7+,8-,9+,10+/m1/s1 |
| InChIKey | DUWCWLUOKVJMMU-KGDYZURWSA-N |
| XLogP | 1.12 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |