C16H25NO4 — CID 130252844
6-O-tert-butyl 7-O-ethyl (1R,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate (PubChem CID 130252844) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 6-O-tert-butyl 7-O-ethyl (1R,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate.
| Compound Name | 6-O-tert-butyl 7-O-ethyl (1R,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 130252844 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 6-O-tert-butyl 7-O-ethyl (1R,3S,4S,5S,7S)-3-methyl-6-azatricyclo[3.2.1.02,4]octane-6,7-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@@H]([C@H]3C(C)C32)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25NO4/c1-6-20-14(18)13-9-7-10(12-8(2)11(9)12)17(13)15(19)21-16(3,4)5/h8-13H,6-7H2,1-5H3/t8?,9-,10+,11?,12-,13+/m1/s1 |
| InChIKey | PQWAIYBERRTKIQ-JFXCXVQXSA-N |
| XLogP | 2.44 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |