C10H16O6 — CID 130253162
prop-2-enyl (2S,3S,4R,5R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylate (PubChem CID 130253162) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4R,5R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4R,5R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 130253162 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | prop-2-enyl (2S,3S,4R,5R)-3,4,5-trihydroxy-6-methyloxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1OC(C)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O6/c1-3-4-15-10(14)9-8(13)7(12)6(11)5(2)16-9/h3,5-9,11-13H,1,4H2,2H3/t5?,6-,7+,8-,9-/m0/s1 |
| InChIKey | NSJSHIWJXXCUOI-OTJDUATISA-N |
| XLogP | -1.41 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|