C22H30ClN7 — CID 130254008
1-(1-aminoethyl)-7-(2-amino-1,2,3,4-tetrahydropyrimidin-5-yl)-5-(4-chlorophenyl)-3-methyl-3,4-dihydro-2H-1,5-benzodiazepin-2-amine (PubChem CID 130254008) has the molecular formula C22H30ClN7 and a molecular weight of 427.98 g/mol. Its IUPAC name is 1-(1-aminoethyl)-7-(2-amino-1,2,3,4-tetrahydropyrimidin-5-yl)-5-(4-chlorophenyl)-3-methyl-3,4-dihydro-2H-1,5-benzodiazepin-2-amine.
| Compound Name | 1-(1-aminoethyl)-7-(2-amino-1,2,3,4-tetrahydropyrimidin-5-yl)-5-(4-chlorophenyl)-3-methyl-3,4-dihydro-2H-1,5-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 130254008 |
| Molecular Formula | C22H30ClN7 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 1-(1-aminoethyl)-7-(2-amino-1,2,3,4-tetrahydropyrimidin-5-yl)-5-(4-chlorophenyl)-3-methyl-3,4-dihydro-2H-1,5-benzodiazepin-2-amine |
| SMILES | CC1CN(c2ccc(Cl)cc2)c2cc(C3=CNC(N)NC3)ccc2N(C(C)N)C1N |
| InChI | InChI=1S/C22H30ClN7/c1-13-12-29(18-6-4-17(23)5-7-18)20-9-15(16-10-27-22(26)28-11-16)3-8-19(20)30(14(2)24)21(13)25/h3-10,13-14,21-22,27-28H,11-12,24-26H2,1-2H3 |
| InChIKey | APFIPXMPKRJYIW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|