About N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine
N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine (PubChem CID 130254325) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine |
| PubChem CID | 130254325 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine |
| SMILES | C/C=C\C=C\OC(C)NC |
| InChI | InChI=1S/C8H15NO/c1-4-5-6-7-10-8(2)9-3/h4-9H,1-3H3/b5-4-,7-6+ |
| InChIKey | UQELEMBBICXAKE-SCFJQAPRSA-N |
| XLogP | 1.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine?
The IUPAC name of N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine (CID 130254325) is N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine.
What is the SMILES notation for N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine?
The canonical SMILES for N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine is C/C=C\C=C\OC(C)NC.
What is the InChIKey of N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine?
The InChIKey is UQELEMBBICXAKE-SCFJQAPRSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-5-6-7-10-8(2)9-3/h4-9H,1-3H3/b5-4-,7-6+.
What are the key properties of N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine?
N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine has a molecular weight of 141.21 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(1E,3Z)-penta-1,3-dienoxy]ethanamine is sourced from PubChem (CID 130254325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).