About tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate
tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 13025451) has the molecular formula C23H37F2NO4
and a molecular weight of 429.55 g/mol. Its IUPAC name is tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate.
Molecular Properties
| Compound Name | tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
| PubChem CID | 13025451 |
| Molecular Formula | C23H37F2NO4 |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)/C=C/C1CCC(=O)N1CCCCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37F2NO4/c1-5-6-16-23(24,25)19(27)14-12-18-13-15-20(28)26(18)17-10-8-7-9-11-21(29)30-22(2,3)4/h12,14,18H,5-11,13,15-17H2,1-4H3/b14-12+ |
| InChIKey | HDVHSTKDBQUKLU-WYMLVPIESA-N |
| XLogP | 5.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate?
The IUPAC name of tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate (CID 13025451) is tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate.
What is the SMILES notation for tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate?
The canonical SMILES for tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate is CCCCC(F)(F)C(=O)/C=C/C1CCC(=O)N1CCCCCCC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate?
The InChIKey is HDVHSTKDBQUKLU-WYMLVPIESA-N. The full InChI is InChI=1S/C23H37F2NO4/c1-5-6-16-23(24,25)19(27)14-12-18-13-15-20(28)26(18)17-10-8-7-9-11-21(29)30-22(2,3)4/h12,14,18H,5-11,13,15-17H2,1-4H3/b14-12+.
What are the key properties of tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate?
tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate has a molecular weight of 429.55 g/mol, XLogP of 5.22, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-[2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate is sourced from PubChem (CID 13025451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).