C24H29N5O7 — CID 130254793
2-[6,9-bis(carboxymethyl)-7-[(4-nitrosophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid (PubChem CID 130254793) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is 2-[6,9-bis(carboxymethyl)-7-[(4-nitrosophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid.
| Compound Name | 2-[6,9-bis(carboxymethyl)-7-[(4-nitrosophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid |
|---|---|
| PubChem CID | 130254793 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[6,9-bis(carboxymethyl)-7-[(4-nitrosophenyl)methyl]-3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-3-yl]acetic acid |
| SMILES | O=Nc1ccc(CC2CN(CC(=O)O)Cc3cccc(n3)CN(CC(=O)O)CCN2CC(=O)O)cc1 |
| InChI | InChI=1S/C24H29N5O7/c30-22(31)14-27-8-9-29(16-24(34)35)21(10-17-4-6-18(26-36)7-5-17)13-28(15-23(32)33)12-20-3-1-2-19(11-27)25-20/h1-7,21H,8-16H2,(H,30,31)(H,32,33)(H,34,35) |
| InChIKey | CXJRQPLMGPBYPQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |