C22H24ClFN4O4S — CID 130254943
(3R,7S)-13-[5-[(3Z,5E)-6-chloro-7-fluoro-2-methylhepta-3,5-dienyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-7-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 130254943) has the molecular formula C22H24ClFN4O4S and a molecular weight of 494.98 g/mol. Its IUPAC name is (3R,7S)-13-[5-[(3Z,5E)-6-chloro-7-fluoro-2-methylhepta-3,5-dienyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-7-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R,7S)-13-[5-[(3Z,5E)-6-chloro-7-fluoro-2-methylhepta-3,5-dienyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-7-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 130254943 |
| Molecular Formula | C22H24ClFN4O4S |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | (3R,7S)-13-[5-[(3Z,5E)-6-chloro-7-fluoro-2-methylhepta-3,5-dienyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-7-methyl-4-oxa-1,8-diazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | CC(/C=C\C=C(\Cl)CF)Cc1nnc(-c2cn3c(c(O)c2=O)C(=O)N2[C@@H](C)CCO[C@@H]2C3)s1 |
| InChI | InChI=1S/C22H24ClFN4O4S/c1-12(4-3-5-14(23)9-24)8-16-25-26-21(33-16)15-10-27-11-17-28(13(2)6-7-32-17)22(31)18(27)20(30)19(15)29/h3-5,10,12-13,17,30H,6-9,11H2,1-2H3/b4-3-,14-5+/t12?,13-,17+/m0/s1 |
| InChIKey | ZJNNCXSVXPKKBE-DKZOBOKESA-N |
| XLogP | 3.49 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|