C13H14F2N2O — CID 130255049
2-butan-2-yl-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole (PubChem CID 130255049) has the molecular formula C13H14F2N2O and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-butan-2-yl-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-butan-2-yl-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130255049 |
| Molecular Formula | C13H14F2N2O |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-butan-2-yl-5-[(2,4-difluorophenyl)methyl]-1,3,4-oxadiazole |
| SMILES | CCC(C)c1nnc(Cc2ccc(F)cc2F)o1 |
| InChI | InChI=1S/C13H14F2N2O/c1-3-8(2)13-17-16-12(18-13)6-9-4-5-10(14)7-11(9)15/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | CHUVNOXAXNTQSH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |