C13H19N3O6 — CID 130255132
7,9-dihydroxy-2,3-bis(2-methoxyethyl)-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione (PubChem CID 130255132) has the molecular formula C13H19N3O6 and a molecular weight of 313.31 g/mol. Its IUPAC name is 7,9-dihydroxy-2,3-bis(2-methoxyethyl)-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione.
| Compound Name | 7,9-dihydroxy-2,3-bis(2-methoxyethyl)-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
|---|---|
| PubChem CID | 130255132 |
| Molecular Formula | C13H19N3O6 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 7,9-dihydroxy-2,3-bis(2-methoxyethyl)-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
| SMILES | COCCN1Cn2cc(O)c(=O)c(O)c2C(=O)N1CCOC |
| InChI | InChI=1S/C13H19N3O6/c1-21-5-3-15-8-14-7-9(17)11(18)12(19)10(14)13(20)16(15)4-6-22-2/h7,17,19H,3-6,8H2,1-2H3 |
| InChIKey | LTIZRVKSKYJZJY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |