About 2-chloro-1,3,4-trimethylcyclohexane
2-chloro-1,3,4-trimethylcyclohexane (PubChem CID 130255173) has the molecular formula C9H17Cl
and a molecular weight of 160.69 g/mol. Its IUPAC name is 2-chloro-1,3,4-trimethylcyclohexane.
Molecular Properties
| Compound Name | 2-chloro-1,3,4-trimethylcyclohexane |
| PubChem CID | 130255173 |
| Molecular Formula | C9H17Cl |
| Molecular Weight | 160.69 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-chloro-1,3,4-trimethylcyclohexane |
| SMILES | CC1CCC(C)C(Cl)C1C |
| InChI | InChI=1S/C9H17Cl/c1-6-4-5-7(2)9(10)8(6)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | NENUZXHPIREUGG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3,4-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,4-trimethylcyclohexane?
The IUPAC name of 2-chloro-1,3,4-trimethylcyclohexane (CID 130255173) is 2-chloro-1,3,4-trimethylcyclohexane.
What is the SMILES notation for 2-chloro-1,3,4-trimethylcyclohexane?
The canonical SMILES for 2-chloro-1,3,4-trimethylcyclohexane is CC1CCC(C)C(Cl)C1C.
What is the InChIKey of 2-chloro-1,3,4-trimethylcyclohexane?
The InChIKey is NENUZXHPIREUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17Cl/c1-6-4-5-7(2)9(10)8(6)3/h6-9H,4-5H2,1-3H3.
What are the key properties of 2-chloro-1,3,4-trimethylcyclohexane?
2-chloro-1,3,4-trimethylcyclohexane has a molecular weight of 160.69 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,4-trimethylcyclohexane is sourced from PubChem (CID 130255173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).