C13H21NO2 — CID 130255616
(E)-1-[3-(2,3,6,7-tetrahydrooxepin-4-yl)propylimino]but-2-en-2-ol (PubChem CID 130255616) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (E)-1-[3-(2,3,6,7-tetrahydrooxepin-4-yl)propylimino]but-2-en-2-ol.
| Compound Name | (E)-1-[3-(2,3,6,7-tetrahydrooxepin-4-yl)propylimino]but-2-en-2-ol |
|---|---|
| PubChem CID | 130255616 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (E)-1-[3-(2,3,6,7-tetrahydrooxepin-4-yl)propylimino]but-2-en-2-ol |
| SMILES | C/C=C(O)\C=N\CCCC1=CCCOCC1 |
| InChI | InChI=1S/C13H21NO2/c1-2-13(15)11-14-8-3-5-12-6-4-9-16-10-7-12/h2,6,11,15H,3-5,7-10H2,1H3/b13-2+,14-11+ |
| InChIKey | ULPIFMHVZBXITK-FGCMNDBJSA-N |
| XLogP | 3.04 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|