About 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine
6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine (PubChem CID 130255757) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine.
Molecular Properties
| Compound Name | 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine |
| PubChem CID | 130255757 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine |
| SMILES | C=CC1=C(C(C)CC)NNN(CC)C1 |
| InChI | InChI=1S/C11H21N3/c1-5-9(4)11-10(6-2)8-14(7-3)13-12-11/h6,9,12-13H,2,5,7-8H2,1,3-4H3 |
| InChIKey | OLDQMCJBQZXNEY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine?
The IUPAC name of 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine (CID 130255757) is 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine.
What is the SMILES notation for 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine?
The canonical SMILES for 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine is C=CC1=C(C(C)CC)NNN(CC)C1.
What is the InChIKey of 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine?
The InChIKey is OLDQMCJBQZXNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-5-9(4)11-10(6-2)8-14(7-3)13-12-11/h6,9,12-13H,2,5,7-8H2,1,3-4H3.
What are the key properties of 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine?
6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine has a molecular weight of 195.31 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-5-ethenyl-3-ethyl-2,4-dihydro-1H-triazine is sourced from PubChem (CID 130255757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).