C11H15N3O4 — CID 130255863
2,3-diethyl-7,9-dihydroxy-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione (PubChem CID 130255863) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2,3-diethyl-7,9-dihydroxy-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione.
| Compound Name | 2,3-diethyl-7,9-dihydroxy-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
|---|---|
| PubChem CID | 130255863 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2,3-diethyl-7,9-dihydroxy-4H-pyrido[1,2-d][1,2,4]triazine-1,8-dione |
| SMILES | CCN1Cn2cc(O)c(=O)c(O)c2C(=O)N1CC |
| InChI | InChI=1S/C11H15N3O4/c1-3-13-6-12-5-7(15)9(16)10(17)8(12)11(18)14(13)4-2/h5,15,17H,3-4,6H2,1-2H3 |
| InChIKey | PCVNRMNVTGVNCO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |