C12H16N2 — CID 130256315
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,5-dimethylimidazole (PubChem CID 130256315) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,5-dimethylimidazole.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,5-dimethylimidazole |
|---|---|
| PubChem CID | 130256315 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1,5-dimethylimidazole |
| SMILES | C=C/C=C(\C=C/C)c1ncn(C)c1C |
| InChI | InChI=1S/C12H16N2/c1-5-7-11(8-6-2)12-10(3)14(4)9-13-12/h5-9H,1H2,2-4H3/b8-6-,11-7+ |
| InChIKey | BUGLYUKDLBYCMD-FAWHLJIPSA-N |
| XLogP | 2.87 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|