About (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine
(Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine (PubChem CID 130256409) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine |
| PubChem CID | 130256409 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine |
| SMILES | CC1=NCC(CCCC/C=C\N)C=C1 |
| InChI | InChI=1S/C12H20N2/c1-11-7-8-12(10-14-11)6-4-2-3-5-9-13/h5,7-9,12H,2-4,6,10,13H2,1H3/b9-5- |
| InChIKey | WBTRYUZCJGLPEX-UITAMQMPSA-N |
| XLogP | 2.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine?
The IUPAC name of (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine (CID 130256409) is (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine.
What is the SMILES notation for (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine?
The canonical SMILES for (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine is CC1=NCC(CCCC/C=C\N)C=C1.
What is the InChIKey of (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine?
The InChIKey is WBTRYUZCJGLPEX-UITAMQMPSA-N. The full InChI is InChI=1S/C12H20N2/c1-11-7-8-12(10-14-11)6-4-2-3-5-9-13/h5,7-9,12H,2-4,6,10,13H2,1H3/b9-5-.
What are the key properties of (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine?
(Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine has a molecular weight of 192.31 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-(6-methyl-2,3-dihydropyridin-3-yl)hex-1-en-1-amine is sourced from PubChem (CID 130256409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).