C8H15N3 — CID 130256413
6-N,2,4-trimethyl-1,2-dihydropyridine-5,6-diamine (PubChem CID 130256413) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 6-N,2,4-trimethyl-1,2-dihydropyridine-5,6-diamine.
| Compound Name | 6-N,2,4-trimethyl-1,2-dihydropyridine-5,6-diamine |
|---|---|
| PubChem CID | 130256413 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 6-N,2,4-trimethyl-1,2-dihydropyridine-5,6-diamine |
| SMILES | CNC1=C(N)C(C)=CC(C)N1 |
| InChI | InChI=1S/C8H15N3/c1-5-4-6(2)11-8(10-3)7(5)9/h4,6,10-11H,9H2,1-3H3 |
| InChIKey | STCWTBFWUSBOMG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |