C14H22O — CID 130256816
[(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]cyclohexane (PubChem CID 130256816) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is [(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]cyclohexane.
| Compound Name | [(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]cyclohexane |
|---|---|
| PubChem CID | 130256816 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | [(1E,3E,5Z)-4-methoxyhepta-1,3,5-trienyl]cyclohexane |
| SMILES | C/C=C\C(=C/C=C/C1CCCCC1)OC |
| InChI | InChI=1S/C14H22O/c1-3-8-14(15-2)12-7-11-13-9-5-4-6-10-13/h3,7-8,11-13H,4-6,9-10H2,1-2H3/b8-3-,11-7+,14-12+ |
| InChIKey | QCUGJLZGVSIMRI-XABFLXPASA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|