C24H44FN — CID 130256882
N-butyl-4-[(6E,8E)-9-fluoro-5,6-dimethylundeca-6,8-dien-2-yl]cycloheptan-1-amine (PubChem CID 130256882) has the molecular formula C24H44FN and a molecular weight of 365.62 g/mol. Its IUPAC name is N-butyl-4-[(6E,8E)-9-fluoro-5,6-dimethylundeca-6,8-dien-2-yl]cycloheptan-1-amine.
| Compound Name | N-butyl-4-[(6E,8E)-9-fluoro-5,6-dimethylundeca-6,8-dien-2-yl]cycloheptan-1-amine |
|---|---|
| PubChem CID | 130256882 |
| Molecular Formula | C24H44FN |
| Molecular Weight | 365.62 g/mol |
| Exact Mass | 365.35 |
| IUPAC Name | N-butyl-4-[(6E,8E)-9-fluoro-5,6-dimethylundeca-6,8-dien-2-yl]cycloheptan-1-amine |
| SMILES | CCCCNC1CCCC(C(C)CCC(C)/C(C)=C/C=C(/F)CC)CC1 |
| InChI | InChI=1S/C24H44FN/c1-6-8-18-26-24-11-9-10-22(15-17-24)21(5)13-12-19(3)20(4)14-16-23(25)7-2/h14,16,19,21-22,24,26H,6-13,15,17-18H2,1-5H3/b20-14+,23-16+ |
| InChIKey | AIQDEFVMGQEVJI-JOJMNHRDSA-N |
| XLogP | 7.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|