C25H27F3N6O5 — CID 130256925
(1R,3S,5R)-2-[2-[2-(2-oxopropanimidoyl)-4-(pyrimidin-2-ylmethoxy)anilino]acetyl]-N-[2-(trifluoromethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 130256925) has the molecular formula C25H27F3N6O5 and a molecular weight of 548.52 g/mol. Its IUPAC name is (1R,3S,5R)-2-[2-[2-(2-oxopropanimidoyl)-4-(pyrimidin-2-ylmethoxy)anilino]acetyl]-N-[2-(trifluoromethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5R)-2-[2-[2-(2-oxopropanimidoyl)-4-(pyrimidin-2-ylmethoxy)anilino]acetyl]-N-[2-(trifluoromethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 130256925 |
| Molecular Formula | C25H27F3N6O5 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (1R,3S,5R)-2-[2-[2-(2-oxopropanimidoyl)-4-(pyrimidin-2-ylmethoxy)anilino]acetyl]-N-[2-(trifluoromethoxy)ethyl]-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | [H]/N=C(\C(C)=O)c1cc(OCc2ncccn2)ccc1NCC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C(=O)NCCOC(F)(F)F |
| InChI | InChI=1S/C25H27F3N6O5/c1-14(35)23(29)17-11-16(38-13-21-30-5-2-6-31-21)3-4-18(17)33-12-22(36)34-19-9-15(19)10-20(34)24(37)32-7-8-39-25(26,27)28/h2-6,11,15,19-20,29,33H,7-10,12-13H2,1H3,(H,32,37)/b29-23+/t15-,19-,20+/m1/s1 |
| InChIKey | CLDLZGBRHLQDBX-MESKNLHWSA-N |
| XLogP | 2.07 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|