C15H21FN2 — CID 130256933
(3Z,5Z)-4-fluoro-3-(1,3,5-trimethylpyrrol-2-yl)octa-3,5,7-trien-1-amine (PubChem CID 130256933) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is (3Z,5Z)-4-fluoro-3-(1,3,5-trimethylpyrrol-2-yl)octa-3,5,7-trien-1-amine.
| Compound Name | (3Z,5Z)-4-fluoro-3-(1,3,5-trimethylpyrrol-2-yl)octa-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 130256933 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (3Z,5Z)-4-fluoro-3-(1,3,5-trimethylpyrrol-2-yl)octa-3,5,7-trien-1-amine |
| SMILES | C=C/C=C\C(F)=C(/CCN)c1c(C)cc(C)n1C |
| InChI | InChI=1S/C15H21FN2/c1-5-6-7-14(16)13(8-9-17)15-11(2)10-12(3)18(15)4/h5-7,10H,1,8-9,17H2,2-4H3/b7-6-,14-13- |
| InChIKey | CUHUJKLJNPZESP-ZBXVJARNSA-N |
| XLogP | 3.41 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|