C10H13N — CID 130257091
(3Z,5Z)-3-ethylocta-3,5,7-trienenitrile (PubChem CID 130257091) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (3Z,5Z)-3-ethylocta-3,5,7-trienenitrile.
| Compound Name | (3Z,5Z)-3-ethylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 130257091 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (3Z,5Z)-3-ethylocta-3,5,7-trienenitrile |
| SMILES | C=C/C=C\C=C(\CC)CC#N |
| InChI | InChI=1S/C10H13N/c1-3-5-6-7-10(4-2)8-9-11/h3,5-7H,1,4,8H2,2H3/b6-5-,10-7- |
| InChIKey | JLYQAIDSQNMUNO-ICZHLNMZSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|