About 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene
8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene (PubChem CID 130257225) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene.
Analyze 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene?
The IUPAC name of 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene (CID 130257225) is 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene.
What is the SMILES notation for 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene?
The canonical SMILES for 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene is CC1=NC2C=C(CCNC2)N1.
What is the InChIKey of 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene?
The InChIKey is PFXBQYWJOMSOBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-6-10-7-2-3-9-5-8(4-7)11-6/h4,8-9H,2-3,5H2,1H3,(H,10,11).
What are the key properties of 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene?
8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene has a molecular weight of 151.21 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,7,9-triazabicyclo[4.3.1]deca-6(10),8-diene is sourced from PubChem (CID 130257225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).