C16H13N3O4S — CID 130257295
methyl N-[5-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynoyl]-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamate (PubChem CID 130257295) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl N-[5-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynoyl]-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynoyl]-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 130257295 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | methyl N-[5-[(2Z,4Z)-2-aminohepta-2,4-dien-6-ynoyl]-4-(furan-2-yl)-1,3-thiazol-2-yl]carbamate |
| SMILES | C#C/C=C\C=C(/N)C(=O)c1sc(NC(=O)OC)nc1-c1ccco1 |
| InChI | InChI=1S/C16H13N3O4S/c1-3-4-5-7-10(17)13(20)14-12(11-8-6-9-23-11)18-15(24-14)19-16(21)22-2/h1,4-9H,17H2,2H3,(H,18,19,21)/b5-4-,10-7- |
| InChIKey | PDFCPTXPYLOODI-WKBXPBOGSA-N |
| XLogP | 2.80 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|