C14H23N5S — CID 130258012
2-N,2-N,6-N,4-tetramethyl-6-N-[2-(2-methylthiophen-3-yl)ethyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 130258012) has the molecular formula C14H23N5S and a molecular weight of 293.44 g/mol. Its IUPAC name is 2-N,2-N,6-N,4-tetramethyl-6-N-[2-(2-methylthiophen-3-yl)ethyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,4-tetramethyl-6-N-[2-(2-methylthiophen-3-yl)ethyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 130258012 |
| Molecular Formula | C14H23N5S |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-N,2-N,6-N,4-tetramethyl-6-N-[2-(2-methylthiophen-3-yl)ethyl]-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | Cc1sccc1CCN(C)C1=NC(C)N=C(N(C)C)N1 |
| InChI | InChI=1S/C14H23N5S/c1-10-12(7-9-20-10)6-8-19(5)14-16-11(2)15-13(17-14)18(3)4/h7,9,11H,6,8H2,1-5H3,(H,15,16,17) |
| InChIKey | KXNMYYFBPDFQMF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |