About 2-amino-5-phenylfuran-3,4-dicarbonitrile
2-amino-5-phenylfuran-3,4-dicarbonitrile (PubChem CID 13025873) has the molecular formula C12H7N3O
and a molecular weight of 209.21 g/mol. Its IUPAC name is 2-amino-5-phenylfuran-3,4-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-5-phenylfuran-3,4-dicarbonitrile |
| PubChem CID | 13025873 |
| Molecular Formula | C12H7N3O |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-amino-5-phenylfuran-3,4-dicarbonitrile |
| SMILES | N#Cc1c(N)oc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C12H7N3O/c13-6-9-10(7-14)12(15)16-11(9)8-4-2-1-3-5-8/h1-5H,15H2 |
| InChIKey | RQWXQXIUXSFKOM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-5-phenylfuran-3,4-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-phenylfuran-3,4-dicarbonitrile?
The IUPAC name of 2-amino-5-phenylfuran-3,4-dicarbonitrile (CID 13025873) is 2-amino-5-phenylfuran-3,4-dicarbonitrile.
What is the SMILES notation for 2-amino-5-phenylfuran-3,4-dicarbonitrile?
The canonical SMILES for 2-amino-5-phenylfuran-3,4-dicarbonitrile is N#Cc1c(N)oc(-c2ccccc2)c1C#N.
What is the InChIKey of 2-amino-5-phenylfuran-3,4-dicarbonitrile?
The InChIKey is RQWXQXIUXSFKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O/c13-6-9-10(7-14)12(15)16-11(9)8-4-2-1-3-5-8/h1-5H,15H2.
What are the key properties of 2-amino-5-phenylfuran-3,4-dicarbonitrile?
2-amino-5-phenylfuran-3,4-dicarbonitrile has a molecular weight of 209.21 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-phenylfuran-3,4-dicarbonitrile is sourced from PubChem (CID 13025873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).