About 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole
5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole (PubChem CID 130260798) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole.
Molecular Properties
| Compound Name | 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole |
| PubChem CID | 130260798 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole |
| SMILES | CC(C)N1Cc2cc[nH]c2C1 |
| InChI | InChI=1S/C9H14N2/c1-7(2)11-5-8-3-4-10-9(8)6-11/h3-4,7,10H,5-6H2,1-2H3 |
| InChIKey | ZFJAYHWUXNOUDA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole?
The IUPAC name of 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole (CID 130260798) is 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole.
What is the SMILES notation for 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole?
The canonical SMILES for 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole is CC(C)N1Cc2cc[nH]c2C1.
What is the InChIKey of 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole?
The InChIKey is ZFJAYHWUXNOUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-7(2)11-5-8-3-4-10-9(8)6-11/h3-4,7,10H,5-6H2,1-2H3.
What are the key properties of 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole?
5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole has a molecular weight of 150.22 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-4,6-dihydro-1H-pyrrolo[3,4-b]pyrrole is sourced from PubChem (CID 130260798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).