C26H19N3 — CID 130261239
2-methyl-4-(4-naphthalen-1-ylphenyl)-6-pyridin-2-ylpyrimidine (PubChem CID 130261239) has the molecular formula C26H19N3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-methyl-4-(4-naphthalen-1-ylphenyl)-6-pyridin-2-ylpyrimidine.
| Compound Name | 2-methyl-4-(4-naphthalen-1-ylphenyl)-6-pyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 130261239 |
| Molecular Formula | C26H19N3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-methyl-4-(4-naphthalen-1-ylphenyl)-6-pyridin-2-ylpyrimidine |
| SMILES | Cc1nc(-c2ccc(-c3cccc4ccccc34)cc2)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C26H19N3/c1-18-28-25(17-26(29-18)24-11-4-5-16-27-24)21-14-12-20(13-15-21)23-10-6-8-19-7-2-3-9-22(19)23/h2-17H,1H3 |
| InChIKey | MFIYBLNVVLJROY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |