C56H35N5 — CID 130261410
2,4-bis(4-pyridin-3-ylphenyl)-6-spiro[fluorene-9,14'-tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene]-11'-yl-1,3,5-triazine (PubChem CID 130261410) has the molecular formula C56H35N5 and a molecular weight of 777.93 g/mol. Its IUPAC name is 2,4-bis(4-pyridin-3-ylphenyl)-6-spiro[fluorene-9,14'-tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene]-11'-yl-1,3,5-triazine.
| Compound Name | 2,4-bis(4-pyridin-3-ylphenyl)-6-spiro[fluorene-9,14'-tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene]-11'-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 130261410 |
| Molecular Formula | C56H35N5 |
| Molecular Weight | 777.93 g/mol |
| Exact Mass | 777.29 |
| IUPAC Name | 2,4-bis(4-pyridin-3-ylphenyl)-6-spiro[fluorene-9,14'-tetracyclo[13.4.0.02,7.08,13]nonadeca-1(19),2,4,6,8(13),9,11,15,17-nonaene]-11'-yl-1,3,5-triazine |
| SMILES | c1cncc(-c2ccc(-c3nc(-c4ccc(-c5cccnc5)cc4)nc(-c4ccc5c(c4)C4(c6ccccc6-c6ccccc6-5)c5ccccc5-c5ccccc54)n3)cc2)c1 |
| InChI | InChI=1S/C56H35N5/c1-2-14-44-43(13-1)45-15-3-6-18-49(45)56(50-19-7-4-16-46(50)47-17-5-8-20-51(47)56)52-33-40(29-30-48(44)52)55-60-53(38-25-21-36(22-26-38)41-11-9-31-57-34-41)59-54(61-55)39-27-23-37(24-28-39)42-12-10-32-58-35-42/h1-35H |
| InChIKey | RRFNGWVZFYGWMD-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.93 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |