C22H22F7NO2 — CID 130261792
N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]heptanamide (PubChem CID 130261792) has the molecular formula C22H22F7NO2 and a molecular weight of 465.41 g/mol. Its IUPAC name is N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]heptanamide.
| Compound Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]heptanamide |
|---|---|
| PubChem CID | 130261792 |
| Molecular Formula | C22H22F7NO2 |
| Molecular Weight | 465.41 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C22H22F7NO2/c1-2-3-4-5-6-19(31)30-16-10-7-14(8-11-16)17-12-9-15(13-18(17)23)20(32,21(24,25)26)22(27,28)29/h7-13,32H,2-6H2,1H3,(H,30,31) |
| InChIKey | GZCWOXGIKJYICC-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.41 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|