C21H18F7NO4 — CID 130261825
methyl 5-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-5-oxopentanoate (PubChem CID 130261825) has the molecular formula C21H18F7NO4 and a molecular weight of 481.36 g/mol. Its IUPAC name is methyl 5-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-5-oxopentanoate.
| Compound Name | methyl 5-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-5-oxopentanoate |
|---|---|
| PubChem CID | 130261825 |
| Molecular Formula | C21H18F7NO4 |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | methyl 5-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]anilino]-5-oxopentanoate |
| SMILES | COC(=O)CCCC(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C21H18F7NO4/c1-33-18(31)4-2-3-17(30)29-14-8-5-12(6-9-14)15-10-7-13(11-16(15)22)19(32,20(23,24)25)21(26,27)28/h5-11,32H,2-4H2,1H3,(H,29,30) |
| InChIKey | VSPWMLMXHQKBHN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |