C50H30N4O2 — CID 130261983
2-[3,5-di(dibenzofuran-4-yl)phenyl]-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine (PubChem CID 130261983) has the molecular formula C50H30N4O2 and a molecular weight of 718.82 g/mol. Its IUPAC name is 2-[3,5-di(dibenzofuran-4-yl)phenyl]-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3,5-di(dibenzofuran-4-yl)phenyl]-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 130261983 |
| Molecular Formula | C50H30N4O2 |
| Molecular Weight | 718.82 g/mol |
| Exact Mass | 718.24 |
| IUPAC Name | 2-[3,5-di(dibenzofuran-4-yl)phenyl]-4-phenyl-6-(4-pyridin-4-ylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccc(-c4ccncc4)cc3)nc(-c3cc(-c4cccc5c4oc4ccccc45)cc(-c4cccc5c4oc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C50H30N4O2/c1-2-10-33(11-3-1)48-52-49(34-22-20-31(21-23-34)32-24-26-51-27-25-32)54-50(53-48)37-29-35(38-14-8-16-42-40-12-4-6-18-44(40)55-46(38)42)28-36(30-37)39-15-9-17-43-41-13-5-7-19-45(41)56-47(39)43/h1-30H |
| InChIKey | CLYBFMISIVIEIU-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.82 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |