C21H18F7NO3 — CID 130262256
N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-oxohexanamide (PubChem CID 130262256) has the molecular formula C21H18F7NO3 and a molecular weight of 465.37 g/mol. Its IUPAC name is N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-oxohexanamide.
| Compound Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-oxohexanamide |
|---|---|
| PubChem CID | 130262256 |
| Molecular Formula | C21H18F7NO3 |
| Molecular Weight | 465.37 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[4-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]-5-oxohexanamide |
| SMILES | CC(=O)CCCC(=O)Nc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)cc1 |
| InChI | InChI=1S/C21H18F7NO3/c1-12(30)3-2-4-18(31)29-15-8-5-13(6-9-15)16-10-7-14(11-17(16)22)19(32,20(23,24)25)21(26,27)28/h5-11,32H,2-4H2,1H3,(H,29,31) |
| InChIKey | SWTPAGMUXSFYMY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |