C8H2F15N — CID 130262465
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,3,3,3-pentafluoropropyl)piperidine (PubChem CID 130262465) has the molecular formula C8H2F15N and a molecular weight of 397.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,3,3,3-pentafluoropropyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,3,3,3-pentafluoropropyl)piperidine |
|---|---|
| PubChem CID | 130262465 |
| Molecular Formula | C8H2F15N |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,3,3,3-pentafluoropropyl)piperidine |
| SMILES | FC(F)(F)CC(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H2F15N/c9-2(10,11)1-3(12,13)24-7(20,21)5(16,17)4(14,15)6(18,19)8(24,22)23/h1H2 |
| InChIKey | DMBNMFGTGCBTRH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|