C12H22F4N3O3+ — CID 130262543
carboxymethyl-[3-[[3-(dimethylamino)-2,2,3,3-tetrafluoropropanoyl]amino]propyl]-dimethylazanium (PubChem CID 130262543) has the molecular formula C12H22F4N3O3+ and a molecular weight of 332.32 g/mol. Its IUPAC name is carboxymethyl-[3-[[3-(dimethylamino)-2,2,3,3-tetrafluoropropanoyl]amino]propyl]-dimethylazanium.
| Compound Name | carboxymethyl-[3-[[3-(dimethylamino)-2,2,3,3-tetrafluoropropanoyl]amino]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 130262543 |
| Molecular Formula | C12H22F4N3O3+ |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | carboxymethyl-[3-[[3-(dimethylamino)-2,2,3,3-tetrafluoropropanoyl]amino]propyl]-dimethylazanium |
| SMILES | CN(C)C(F)(F)C(F)(F)C(=O)NCCC[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C12H21F4N3O3/c1-18(2)12(15,16)11(13,14)10(22)17-6-5-7-19(3,4)8-9(20)21/h5-8H2,1-4H3,(H-,17,20,21,22)/p+1 |
| InChIKey | DWFSXKKJMBJNTQ-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|