C50H30N4S2 — CID 130262585
4-[3,5-di(dibenzothiophen-4-yl)phenyl]-2-phenyl-6-(3-pyrimidin-2-ylphenyl)pyrimidine (PubChem CID 130262585) has the molecular formula C50H30N4S2 and a molecular weight of 750.95 g/mol. Its IUPAC name is 4-[3,5-di(dibenzothiophen-4-yl)phenyl]-2-phenyl-6-(3-pyrimidin-2-ylphenyl)pyrimidine.
| Compound Name | 4-[3,5-di(dibenzothiophen-4-yl)phenyl]-2-phenyl-6-(3-pyrimidin-2-ylphenyl)pyrimidine |
|---|---|
| PubChem CID | 130262585 |
| Molecular Formula | C50H30N4S2 |
| Molecular Weight | 750.95 g/mol |
| Exact Mass | 750.19 |
| IUPAC Name | 4-[3,5-di(dibenzothiophen-4-yl)phenyl]-2-phenyl-6-(3-pyrimidin-2-ylphenyl)pyrimidine |
| SMILES | c1ccc(-c2nc(-c3cccc(-c4ncccn4)c3)cc(-c3cc(-c4cccc5c4sc4ccccc45)cc(-c4cccc5c4sc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C50H30N4S2/c1-2-12-31(13-3-1)50-53-43(32-14-8-15-33(26-32)49-51-24-11-25-52-49)30-44(54-50)36-28-34(37-18-9-20-41-39-16-4-6-22-45(39)55-47(37)41)27-35(29-36)38-19-10-21-42-40-17-5-7-23-46(40)56-48(38)42/h1-30H |
| InChIKey | TUAIISZPJAKMEU-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.95 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |